C24H30N2O4S — CID 4950878
ethyl 4-[(4-heptoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 4950878) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is ethyl 4-[(4-heptoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[(4-heptoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4950878 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | ethyl 4-[(4-heptoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-3-5-6-7-8-17-30-21-15-11-18(12-16-21)22(27)26-24(31)25-20-13-9-19(10-14-20)23(28)29-4-2/h9-16H,3-8,17H2,1-2H3,(H2,25,26,27,31) |
| InChIKey | NTILUKSKEKHACW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|