C25H34N2O4S — CID 17130764
N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-4-heptoxybenzamide (PubChem CID 17130764) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 17130764 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(OCCOCC)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O4S/c1-3-5-6-7-8-17-30-22-13-9-20(10-14-22)24(28)27-25(32)26-21-11-15-23(16-12-21)31-19-18-29-4-2/h9-16H,3-8,17-19H2,1-2H3,(H2,26,27,28,32) |
| InChIKey | UBXXDODTZFKVJV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|