C25H33N3O4S — CID 17196571
4-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N,N-dipropylbenzamide (PubChem CID 17196571) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 4-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 17196571 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCOCC)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O4S/c1-4-15-28(16-5-2)24(30)20-7-11-21(12-8-20)26-25(33)27-23(29)19-9-13-22(14-10-19)32-18-17-31-6-3/h7-14H,4-6,15-18H2,1-3H3,(H2,26,27,29,33) |
| InChIKey | ZCQLCONVMDNCSE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|