C28H32N2O4 — CID 17196210
4-[[4-(2-phenoxyethoxy)benzoyl]amino]-N,N-dipropylbenzamide (PubChem CID 17196210) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 4-[[4-(2-phenoxyethoxy)benzoyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[4-(2-phenoxyethoxy)benzoyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 17196210 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-[[4-(2-phenoxyethoxy)benzoyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O4/c1-3-18-30(19-4-2)28(32)23-10-14-24(15-11-23)29-27(31)22-12-16-26(17-13-22)34-21-20-33-25-8-6-5-7-9-25/h5-17H,3-4,18-21H2,1-2H3,(H,29,31) |
| InChIKey | PDSTVLRKHXVDTO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|