C26H29NO3 — CID 17130195
4-butoxy-N-[4-(3-phenylpropoxy)phenyl]benzamide (PubChem CID 17130195) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-butoxy-N-[4-(3-phenylpropoxy)phenyl]benzamide.
| Compound Name | 4-butoxy-N-[4-(3-phenylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17130195 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-butoxy-N-[4-(3-phenylpropoxy)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(OCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-2-3-19-29-24-15-11-22(12-16-24)26(28)27-23-13-17-25(18-14-23)30-20-7-10-21-8-5-4-6-9-21/h4-6,8-9,11-18H,2-3,7,10,19-20H2,1H3,(H,27,28) |
| InChIKey | YVZNLDCABNIZOZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|