C27H31NO3 — CID 4950725
4-heptoxy-N-(4-phenylmethoxyphenyl)benzamide (PubChem CID 4950725) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-heptoxy-N-(4-phenylmethoxyphenyl)benzamide.
| Compound Name | 4-heptoxy-N-(4-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4950725 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-heptoxy-N-(4-phenylmethoxyphenyl)benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-2-3-4-5-9-20-30-25-16-12-23(13-17-25)27(29)28-24-14-18-26(19-15-24)31-21-22-10-7-6-8-11-22/h6-8,10-19H,2-5,9,20-21H2,1H3,(H,28,29) |
| InChIKey | FRHHWACFBCQWMG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|