C29H32N2O5 — CID 10239010
2-[benzyl-[[4-[(4-hexoxybenzoyl)amino]phenyl]methyl]amino]-2-oxoacetic acid (PubChem CID 10239010) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[benzyl-[[4-[(4-hexoxybenzoyl)amino]phenyl]methyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[benzyl-[[4-[(4-hexoxybenzoyl)amino]phenyl]methyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 10239010 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[benzyl-[[4-[(4-hexoxybenzoyl)amino]phenyl]methyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(CN(Cc3ccccc3)C(=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O5/c1-2-3-4-8-19-36-26-17-13-24(14-18-26)27(32)30-25-15-11-23(12-16-25)21-31(28(33)29(34)35)20-22-9-6-5-7-10-22/h5-7,9-18H,2-4,8,19-21H2,1H3,(H,30,32)(H,34,35) |
| InChIKey | FTIHOVWXUHDSKE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|