C28H32N2O3 — CID 43887413
N-benzyl-4-[(4-heptoxybenzoyl)amino]benzamide (PubChem CID 43887413) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-benzyl-4-[(4-heptoxybenzoyl)amino]benzamide.
| Compound Name | N-benzyl-4-[(4-heptoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 43887413 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-benzyl-4-[(4-heptoxybenzoyl)amino]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2ccc(C(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-2-3-4-5-9-20-33-26-18-14-24(15-19-26)28(32)30-25-16-12-23(13-17-25)27(31)29-21-22-10-7-6-8-11-22/h6-8,10-19H,2-5,9,20-21H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | POFGPJKQEZAIDJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|