C29H32N4O4S — CID 4951104
N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide (PubChem CID 4951104) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 4951104 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O4S/c1-2-3-4-5-9-20-37-25-18-14-22(15-19-25)27(35)31-29(38)33-32-28(36)23-12-16-24(17-13-23)30-26(34)21-10-7-6-8-11-21/h6-8,10-19H,2-5,9,20H2,1H3,(H,30,34)(H,32,36)(H2,31,33,35,38) |
| InChIKey | MLGNEIQMZHVJBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|