C22H26ClN3O3S — CID 4951050
N-[[(4-chlorobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide (PubChem CID 4951050) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is N-[[(4-chlorobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[[(4-chlorobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 4951050 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[[(4-chlorobenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClN3O3S/c1-2-3-4-5-6-15-29-19-13-9-16(10-14-19)20(27)24-22(30)26-25-21(28)17-7-11-18(23)12-8-17/h7-14H,2-6,15H2,1H3,(H,25,28)(H2,24,26,27,30) |
| InChIKey | VUGSJLBJZWBNBZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|