C26H34N4O4S — CID 4934688
4-hexoxy-N-[[[4-(pentanoylamino)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 4934688) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-hexoxy-N-[[[4-(pentanoylamino)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 4-hexoxy-N-[[[4-(pentanoylamino)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4934688 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-hexoxy-N-[[[4-(pentanoylamino)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)CCCC)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O4S/c1-3-5-7-8-18-34-22-16-12-19(13-17-22)24(32)28-26(35)30-29-25(33)20-10-14-21(15-11-20)27-23(31)9-6-4-2/h10-17H,3-9,18H2,1-2H3,(H,27,31)(H,29,33)(H2,28,30,32,35) |
| InChIKey | XIHDLSTYJBRLNA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|