C27H28N4O5S — CID 4953184
N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 4953184) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4953184 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O5S/c1-2-6-24(32)28-21-13-9-20(10-14-21)26(34)30-31-27(37)29-25(33)19-11-15-23(16-12-19)36-18-17-35-22-7-4-3-5-8-22/h3-5,7-16H,2,6,17-18H2,1H3,(H,28,32)(H,30,34)(H2,29,31,33,37) |
| InChIKey | KEAORRZQZQICNJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|