C15H21N3O3S — CID 17340166
N-[(butanoylamino)carbamothioyl]-4-propoxybenzamide (PubChem CID 17340166) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[(butanoylamino)carbamothioyl]-4-propoxybenzamide.
| Compound Name | N-[(butanoylamino)carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 17340166 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(butanoylamino)carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)NNC(=O)CCC)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-5-13(19)17-18-15(22)16-14(20)11-6-8-12(9-7-11)21-10-4-2/h6-9H,3-5,10H2,1-2H3,(H,17,19)(H2,16,18,20,22) |
| InChIKey | BLVDOZGMEPTRDX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|