C27H37N3O4S — CID 4934719
4-hexoxy-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 4934719) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is 4-hexoxy-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 4-hexoxy-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4934719 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 4-hexoxy-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=S)NC(=O)c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H37N3O4S/c1-3-5-7-9-19-33-23-15-11-21(12-16-23)25(31)28-27(35)30-29-26(32)22-13-17-24(18-14-22)34-20-10-8-6-4-2/h11-18H,3-10,19-20H2,1-2H3,(H,29,32)(H2,28,30,31,35) |
| InChIKey | RJMHHZXGKAYBAC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|