C23H28BrN3O4S — CID 4951077
N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-4-heptoxybenzamide (PubChem CID 4951077) has the molecular formula C23H28BrN3O4S and a molecular weight of 522.47 g/mol. Its IUPAC name is N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 4951077 |
| Molecular Formula | C23H28BrN3O4S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H28BrN3O4S/c1-3-4-5-6-7-14-31-18-11-8-16(9-12-18)21(28)25-23(32)27-26-22(29)17-10-13-20(30-2)19(24)15-17/h8-13,15H,3-7,14H2,1-2H3,(H,26,29)(H2,25,27,28,32) |
| InChIKey | CGXLNYQOQJPPRG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|