C26H34BrN3O4S — CID 4959974
3-bromo-4-hexoxy-N-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 4959974) has the molecular formula C26H34BrN3O4S and a molecular weight of 564.55 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4959974 |
| Molecular Formula | C26H34BrN3O4S |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(OCCC(C)C)cc2)cc1Br |
| InChI | InChI=1S/C26H34BrN3O4S/c1-4-5-6-7-15-34-23-13-10-20(17-22(23)27)24(31)28-26(35)30-29-25(32)19-8-11-21(12-9-19)33-16-14-18(2)3/h8-13,17-18H,4-7,14-16H2,1-3H3,(H,29,32)(H2,28,30,31,35) |
| InChIKey | CYRYNVQONTWVAW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|