C23H26ClN3O3S — CID 17195925
(E)-3-(4-chlorophenyl)-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]prop-2-enamide (PubChem CID 17195925) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17195925 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[(4-hexoxybenzoyl)amino]carbamothioyl]prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=S)NC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-2-3-4-5-16-30-20-13-9-18(10-14-20)22(29)26-27-23(31)25-21(28)15-8-17-6-11-19(24)12-7-17/h6-15H,2-5,16H2,1H3,(H,26,29)(H2,25,27,28,31)/b15-8+ |
| InChIKey | HKLCWUQWTRSVKI-OVCLIPMQSA-N |
| XLogP | 4.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|