C22H25N3O5 — CID 17187078
4-hexoxy-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]benzohydrazide (PubChem CID 17187078) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-hexoxy-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 17187078 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-hexoxy-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-2-3-4-5-16-30-20-13-9-18(10-14-20)22(27)24-23-21(26)15-8-17-6-11-19(12-7-17)25(28)29/h6-15H,2-5,16H2,1H3,(H,23,26)(H,24,27)/b15-8+ |
| InChIKey | AAFSQZKTWKTFAS-OVCLIPMQSA-N |
| XLogP | 4.03 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|