About formic acid;1-hexoxy-4-nitrobenzene
formic acid;1-hexoxy-4-nitrobenzene (PubChem CID 171658812) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is formic acid;1-hexoxy-4-nitrobenzene.
Molecular Properties
| Compound Name | formic acid;1-hexoxy-4-nitrobenzene |
| PubChem CID | 171658812 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | formic acid;1-hexoxy-4-nitrobenzene |
| SMILES | CCCCCCOc1ccc([N+](=O)[O-])cc1.O=CO |
| InChI | InChI=1S/C12H17NO3.CH2O2/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15;2-1-3/h6-9H,2-5,10H2,1H3;1H,(H,2,3) |
| InChIKey | ULIVTSASSHPOER-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-hexoxy-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-hexoxy-4-nitrobenzene?
The IUPAC name of formic acid;1-hexoxy-4-nitrobenzene (CID 171658812) is formic acid;1-hexoxy-4-nitrobenzene.
What is the SMILES notation for formic acid;1-hexoxy-4-nitrobenzene?
The canonical SMILES for formic acid;1-hexoxy-4-nitrobenzene is CCCCCCOc1ccc([N+](=O)[O-])cc1.O=CO.
What is the InChIKey of formic acid;1-hexoxy-4-nitrobenzene?
The InChIKey is ULIVTSASSHPOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3.CH2O2/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15;2-1-3/h6-9H,2-5,10H2,1H3;1H,(H,2,3).
What are the key properties of formic acid;1-hexoxy-4-nitrobenzene?
formic acid;1-hexoxy-4-nitrobenzene has a molecular weight of 269.30 g/mol, XLogP of 3.25, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-hexoxy-4-nitrobenzene is sourced from PubChem (CID 171658812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).