C21H25N3O6 — CID 4930776
4-hexoxy-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide (PubChem CID 4930776) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-hexoxy-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4930776 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-hexoxy-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H25N3O6/c1-2-3-4-5-14-29-18-10-6-16(7-11-18)21(26)23-22-20(25)15-30-19-12-8-17(9-13-19)24(27)28/h6-13H,2-5,14-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | AHJOWRPOWMCRCC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|