C17H22N2O5 — CID 4930678
4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid (PubChem CID 4930678) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 4930678 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)C=CC(=O)O)cc1 |
| InChI | InChI=1S/C17H22N2O5/c1-2-3-4-5-12-24-14-8-6-13(7-9-14)17(23)19-18-15(20)10-11-16(21)22/h6-11H,2-5,12H2,1H3,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | SDRPDUBTTHZYSC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|