C21H23ClN2O3 — CID 17195627
N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3-methylbutoxy)benzohydrazide (PubChem CID 17195627) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 17195627 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3-methylbutoxy)benzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-15(2)13-14-27-19-10-6-17(7-11-19)21(26)24-23-20(25)12-5-16-3-8-18(22)9-4-16/h3-12,15H,13-14H2,1-2H3,(H,23,25)(H,24,26)/b12-5+ |
| InChIKey | VLWIUUDPYPZVHH-LFYBBSHMSA-N |
| XLogP | 4.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|