C25H26N2O3 — CID 4927927
4-(3-methylbutoxy)-N'-(3-naphthalen-1-ylprop-2-enoyl)benzohydrazide (PubChem CID 4927927) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N'-(3-naphthalen-1-ylprop-2-enoyl)benzohydrazide.
| Compound Name | 4-(3-methylbutoxy)-N'-(3-naphthalen-1-ylprop-2-enoyl)benzohydrazide |
|---|---|
| PubChem CID | 4927927 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-(3-methylbutoxy)-N'-(3-naphthalen-1-ylprop-2-enoyl)benzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNC(=O)C=Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-18(2)16-17-30-22-13-10-21(11-14-22)25(29)27-26-24(28)15-12-20-8-5-7-19-6-3-4-9-23(19)20/h3-15,18H,16-17H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | JYSWAKLZYOLVSL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|