C25H24N2O5 — CID 6233056
propyl 4-[2-[2-[(E)-3-naphthalen-1-ylprop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 6233056) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is propyl 4-[2-[2-[(E)-3-naphthalen-1-ylprop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | propyl 4-[2-[2-[(E)-3-naphthalen-1-ylprop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 6233056 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | propyl 4-[2-[2-[(E)-3-naphthalen-1-ylprop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NNC(=O)/C=C/c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-2-16-31-25(30)20-10-13-21(14-11-20)32-17-24(29)27-26-23(28)15-12-19-8-5-7-18-6-3-4-9-22(18)19/h3-15H,2,16-17H2,1H3,(H,26,28)(H,27,29)/b15-12+ |
| InChIKey | PKOCPLVDHWOJPN-NTCAYCPXSA-N |
| XLogP | 3.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|