C22H20N2O4 — CID 4146389
N'-[2-(4-methoxyphenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide (PubChem CID 4146389) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide.
| Compound Name | N'-[2-(4-methoxyphenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 4146389 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N'-[2-(4-methoxyphenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)C=Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-27-18-10-12-19(13-11-18)28-15-22(26)24-23-21(25)14-9-17-7-4-6-16-5-2-3-8-20(16)17/h2-14H,15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ACSDUIBQHIQFRW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|