C21H16Cl2N2O3 — CID 5191338
N'-[2-(2,4-dichlorophenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide (PubChem CID 5191338) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 5191338 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-naphthalen-1-ylprop-2-enehydrazide |
| SMILES | O=C(C=Cc1cccc2ccccc12)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-16-9-10-19(18(23)12-16)28-13-21(27)25-24-20(26)11-8-15-6-3-5-14-4-1-2-7-17(14)15/h1-12H,13H2,(H,24,26)(H,25,27) |
| InChIKey | CFLCNDHGGPQVBD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|