C21H20Cl4N4O6 — CID 3363801
1-N',5-N'-bis[2-(2,4-dichlorophenoxy)acetyl]pentanedihydrazide (PubChem CID 3363801) has the molecular formula C21H20Cl4N4O6 and a molecular weight of 566.23 g/mol. Its IUPAC name is 1-N',5-N'-bis[2-(2,4-dichlorophenoxy)acetyl]pentanedihydrazide.
| Compound Name | 1-N',5-N'-bis[2-(2,4-dichlorophenoxy)acetyl]pentanedihydrazide |
|---|---|
| PubChem CID | 3363801 |
| Molecular Formula | C21H20Cl4N4O6 |
| Molecular Weight | 566.23 g/mol |
| Exact Mass | 564.01 |
| IUPAC Name | 1-N',5-N'-bis[2-(2,4-dichlorophenoxy)acetyl]pentanedihydrazide |
| SMILES | O=C(CCCC(=O)NNC(=O)COc1ccc(Cl)cc1Cl)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl4N4O6/c22-12-4-6-16(14(24)8-12)34-10-20(32)28-26-18(30)2-1-3-19(31)27-29-21(33)11-35-17-7-5-13(23)9-15(17)25/h4-9H,1-3,10-11H2,(H,26,30)(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | OIHWBRLENMMXIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|