C18H16BrCl3N2O4 — CID 5229244
N'-[2-(2-bromo-4-chlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide (PubChem CID 5229244) has the molecular formula C18H16BrCl3N2O4 and a molecular weight of 510.60 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-chlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide.
| Compound Name | N'-[2-(2-bromo-4-chlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide |
|---|---|
| PubChem CID | 5229244 |
| Molecular Formula | C18H16BrCl3N2O4 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 507.94 |
| IUPAC Name | N'-[2-(2-bromo-4-chlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C18H16BrCl3N2O4/c19-13-8-11(20)3-5-15(13)28-10-18(26)24-23-17(25)2-1-7-27-16-6-4-12(21)9-14(16)22/h3-6,8-9H,1-2,7,10H2,(H,23,25)(H,24,26) |
| InChIKey | FQTKBGLIRGDIHX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|