C24H28Cl4N2O4 — CID 2841733
4-(2,4-dichlorophenoxy)-N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]butyl]butanamide (PubChem CID 2841733) has the molecular formula C24H28Cl4N2O4 and a molecular weight of 550.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]butyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]butyl]butanamide |
|---|---|
| PubChem CID | 2841733 |
| Molecular Formula | C24H28Cl4N2O4 |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]butyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCCCCNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H28Cl4N2O4/c25-17-7-9-21(19(27)15-17)33-13-3-5-23(31)29-11-1-2-12-30-24(32)6-4-14-34-22-10-8-18(26)16-20(22)28/h7-10,15-16H,1-6,11-14H2,(H,29,31)(H,30,32) |
| InChIKey | RPMHZPXKOKBIHP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|