C16H19Cl2N3O2 — CID 2842888
4-(2,4-dichlorophenoxy)-N-(3-imidazol-1-ylpropyl)butanamide (PubChem CID 2842888) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(3-imidazol-1-ylpropyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(3-imidazol-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 2842888 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(3-imidazol-1-ylpropyl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCCCn1ccnc1 |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-13-4-5-15(14(18)11-13)23-10-1-3-16(22)20-6-2-8-21-9-7-19-12-21/h4-5,7,9,11-12H,1-3,6,8,10H2,(H,20,22) |
| InChIKey | VWDIBKBXOACWRL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|