C20H23Cl2NO2 — CID 2841932
4-(2,4-dichlorophenoxy)-N-(4-phenylbutyl)butanamide (PubChem CID 2841932) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(4-phenylbutyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(4-phenylbutyl)butanamide |
|---|---|
| PubChem CID | 2841932 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(4-phenylbutyl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCCCCc1ccccc1 |
| InChI | InChI=1S/C20H23Cl2NO2/c21-17-11-12-19(18(22)15-17)25-14-6-10-20(24)23-13-5-4-9-16-7-2-1-3-8-16/h1-3,7-8,11-12,15H,4-6,9-10,13-14H2,(H,23,24) |
| InChIKey | UGBVSADWNNJJPD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|