C14H19Cl2N3O3 — CID 68958426
2-(2,4-dichlorophenoxy)-N-(6-hydrazinyl-6-oxohexyl)acetamide (PubChem CID 68958426) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-hydrazinyl-6-oxohexyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-hydrazinyl-6-oxohexyl)acetamide |
|---|---|
| PubChem CID | 68958426 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-hydrazinyl-6-oxohexyl)acetamide |
| SMILES | NNC(=O)CCCCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O3/c15-10-5-6-12(11(16)8-10)22-9-14(21)18-7-3-1-2-4-13(20)19-17/h5-6,8H,1-4,7,9,17H2,(H,18,21)(H,19,20) |
| InChIKey | KUZCIWCWXXYWQP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|