C14H17Cl2NO3 — CID 89195114
2-(2,4-dichlorophenoxy)-N-(6-oxohexyl)acetamide (PubChem CID 89195114) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-oxohexyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-oxohexyl)acetamide |
|---|---|
| PubChem CID | 89195114 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-oxohexyl)acetamide |
| SMILES | O=CCCCCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO3/c15-11-5-6-13(12(16)9-11)20-10-14(19)17-7-3-1-2-4-8-18/h5-6,8-9H,1-4,7,10H2,(H,17,19) |
| InChIKey | IWTUQEPWHUFHBR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|