C14H19Cl2NO4 — CID 134029604
2-(2,4-dichlorophenoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide (PubChem CID 134029604) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 134029604 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide |
| SMILES | COCCOCCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO4/c1-19-7-8-20-6-2-5-17-14(18)10-21-13-4-3-11(15)9-12(13)16/h3-4,9H,2,5-8,10H2,1H3,(H,17,18) |
| InChIKey | YCCCZEUBJMFLGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|