C14H19Cl2NO3 — CID 2227549
4-(2,4-dichlorophenoxy)-N-(3-methoxypropyl)butanamide (PubChem CID 2227549) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(3-methoxypropyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 2227549 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(3-methoxypropyl)butanamide |
| SMILES | COCCCNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO3/c1-19-8-3-7-17-14(18)4-2-9-20-13-6-5-11(15)10-12(13)16/h5-6,10H,2-4,7-9H2,1H3,(H,17,18) |
| InChIKey | ZXGDJPWYCGPBNV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|