C13H17Cl2NO2 — CID 94001130
3-(2,4-dichlorophenyl)-N-(3-methoxypropyl)propanamide (PubChem CID 94001130) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 94001130 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-18-8-2-7-16-13(17)6-4-10-3-5-11(14)9-12(10)15/h3,5,9H,2,4,6-8H2,1H3,(H,16,17) |
| InChIKey | MEUDNXLHHHHLKX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|