C18H25Cl2NO2 — CID 100608367
N-(3-cyclohexyloxypropyl)-3-(2,4-dichlorophenyl)propanamide (PubChem CID 100608367) has the molecular formula C18H25Cl2NO2 and a molecular weight of 358.31 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100608367 |
| Molecular Formula | C18H25Cl2NO2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C18H25Cl2NO2/c19-15-9-7-14(17(20)13-15)8-10-18(22)21-11-4-12-23-16-5-2-1-3-6-16/h7,9,13,16H,1-6,8,10-12H2,(H,21,22) |
| InChIKey | ATPHASRYTKETAI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|