C16H21ClFNO2 — CID 100564682
2-(4-chloro-2-fluorophenyl)-N-(3-cyclopentyloxypropyl)acetamide (PubChem CID 100564682) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-N-(3-cyclopentyloxypropyl)acetamide.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-N-(3-cyclopentyloxypropyl)acetamide |
|---|---|
| PubChem CID | 100564682 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-N-(3-cyclopentyloxypropyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1F)NCCCOC1CCCC1 |
| InChI | InChI=1S/C16H21ClFNO2/c17-13-7-6-12(15(18)11-13)10-16(20)19-8-3-9-21-14-4-1-2-5-14/h6-7,11,14H,1-5,8-10H2,(H,19,20) |
| InChIKey | MHGYEGZJRDMTST-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|