C16H21BrClNO2 — CID 103763503
2-bromo-4-chloro-N-(3-cyclohexyloxypropyl)benzamide (PubChem CID 103763503) has the molecular formula C16H21BrClNO2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(3-cyclohexyloxypropyl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(3-cyclohexyloxypropyl)benzamide |
|---|---|
| PubChem CID | 103763503 |
| Molecular Formula | C16H21BrClNO2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-bromo-4-chloro-N-(3-cyclohexyloxypropyl)benzamide |
| SMILES | O=C(NCCCOC1CCCCC1)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C16H21BrClNO2/c17-15-11-12(18)7-8-14(15)16(20)19-9-4-10-21-13-5-2-1-3-6-13/h7-8,11,13H,1-6,9-10H2,(H,19,20) |
| InChIKey | UUIHGJLBSUMZAZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|