C16H22FNO2 — CID 60668652
N-(3-cyclohexyloxypropyl)-4-fluorobenzamide (PubChem CID 60668652) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-4-fluorobenzamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 60668652 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-4-fluorobenzamide |
| SMILES | O=C(NCCCOC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FNO2/c17-14-9-7-13(8-10-14)16(19)18-11-4-12-20-15-5-2-1-3-6-15/h7-10,15H,1-6,11-12H2,(H,18,19) |
| InChIKey | MVSFNNOXNWADJK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|