C21H33FN4O2 — CID 111398263
N-[2-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111398263) has the molecular formula C21H33FN4O2 and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[2-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111398263 |
| Molecular Formula | C21H33FN4O2 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N-[2-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCCNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H33FN4O2/c1-16-9-10-17(15-19(16)22)20(27)24-12-13-26-21(23-2)25-11-6-14-28-18-7-4-3-5-8-18/h9-10,15,18H,3-8,11-14H2,1-2H3,(H,24,27)(H2,23,25,26) |
| InChIKey | AKBVPRUEVFRSDT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|