C19H26ClNO3 — CID 134029986
4-(4-chlorophenyl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide (PubChem CID 134029986) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 134029986 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C19H26ClNO3/c20-16-9-7-15(8-10-16)18(22)11-12-19(23)21-13-4-14-24-17-5-2-1-3-6-17/h7-10,17H,1-6,11-14H2,(H,21,23) |
| InChIKey | JAXVDVFXAKIINE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|