C17H23Cl2NO2 — CID 100603333
N-(3-cyclopentyloxypropyl)-3-(2,6-dichlorophenyl)propanamide (PubChem CID 100603333) has the molecular formula C17H23Cl2NO2 and a molecular weight of 344.28 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-3-(2,6-dichlorophenyl)propanamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-3-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100603333 |
| Molecular Formula | C17H23Cl2NO2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-3-(2,6-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1c(Cl)cccc1Cl)NCCCOC1CCCC1 |
| InChI | InChI=1S/C17H23Cl2NO2/c18-15-7-3-8-16(19)14(15)9-10-17(21)20-11-4-12-22-13-5-1-2-6-13/h3,7-8,13H,1-2,4-6,9-12H2,(H,20,21) |
| InChIKey | IOBCNXMERCZPDR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|