C17H24ClNO3S — CID 134030077
4-(5-chlorothiophen-2-yl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide (PubChem CID 134030077) has the molecular formula C17H24ClNO3S and a molecular weight of 357.90 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 134030077 |
| Molecular Formula | C17H24ClNO3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-(3-cyclohexyloxypropyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C17H24ClNO3S/c18-16-9-8-15(23-16)14(20)7-10-17(21)19-11-4-12-22-13-5-2-1-3-6-13/h8-9,13H,1-7,10-12H2,(H,19,21) |
| InChIKey | XFDBUKWABLJXPI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|