C16H15Cl2NO2S2 — CID 55408934
N-[2-(4-chlorophenyl)sulfanylethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide (PubChem CID 55408934) has the molecular formula C16H15Cl2NO2S2 and a molecular weight of 388.34 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55408934 |
| Molecular Formula | C16H15Cl2NO2S2 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO2S2/c17-11-1-3-12(4-2-11)22-10-9-19-16(21)8-5-13(20)14-6-7-15(18)23-14/h1-4,6-7H,5,8-10H2,(H,19,21) |
| InChIKey | RFBYFXKRKPQSSW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|