C13H20Cl2N2OS — CID 120559309
4-amino-N-[2-(4-chlorophenyl)sulfanylethyl]pentanamide;hydrochloride (PubChem CID 120559309) has the molecular formula C13H20Cl2N2OS and a molecular weight of 323.29 g/mol. Its IUPAC name is 4-amino-N-[2-(4-chlorophenyl)sulfanylethyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(4-chlorophenyl)sulfanylethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559309 |
| Molecular Formula | C13H20Cl2N2OS |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-amino-N-[2-(4-chlorophenyl)sulfanylethyl]pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NCCSc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C13H19ClN2OS.ClH/c1-10(15)2-7-13(17)16-8-9-18-12-5-3-11(14)4-6-12;/h3-6,10H,2,7-9,15H2,1H3,(H,16,17);1H |
| InChIKey | DMQGSDITKQDCOC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|