C13H20Cl2N2O3S — CID 120560399
4-amino-N-[2-(4-chlorophenyl)sulfonylethyl]pentanamide;hydrochloride (PubChem CID 120560399) has the molecular formula C13H20Cl2N2O3S and a molecular weight of 355.29 g/mol. Its IUPAC name is 4-amino-N-[2-(4-chlorophenyl)sulfonylethyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(4-chlorophenyl)sulfonylethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120560399 |
| Molecular Formula | C13H20Cl2N2O3S |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-amino-N-[2-(4-chlorophenyl)sulfonylethyl]pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NCCS(=O)(=O)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C13H19ClN2O3S.ClH/c1-10(15)2-7-13(17)16-8-9-20(18,19)12-5-3-11(14)4-6-12;/h3-6,10H,2,7-9,15H2,1H3,(H,16,17);1H |
| InChIKey | LHTHPPKGDWAYOH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |