C13H19ClN2O3S2 — CID 119290592
(2S)-2-amino-N-[2-(4-chlorophenyl)sulfonylethyl]-4-methylsulfanylbutanamide (PubChem CID 119290592) has the molecular formula C13H19ClN2O3S2 and a molecular weight of 350.89 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(4-chlorophenyl)sulfonylethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(4-chlorophenyl)sulfonylethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119290592 |
| Molecular Formula | C13H19ClN2O3S2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2S)-2-amino-N-[2-(4-chlorophenyl)sulfonylethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2O3S2/c1-20-8-6-12(15)13(17)16-7-9-21(18,19)11-4-2-10(14)3-5-11/h2-5,12H,6-9,15H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | RMCIYFNOOYTASM-LBPRGKRZSA-N |
| XLogP | 1.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |