C8H18N2OS2 — CID 63959512
(2S)-2-amino-4-methylsulfanyl-N-(2-methylsulfanylethyl)butanamide (PubChem CID 63959512) has the molecular formula C8H18N2OS2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-(2-methylsulfanylethyl)butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-(2-methylsulfanylethyl)butanamide |
|---|---|
| PubChem CID | 63959512 |
| Molecular Formula | C8H18N2OS2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-(2-methylsulfanylethyl)butanamide |
| SMILES | CSCCNC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C8H18N2OS2/c1-12-5-3-7(9)8(11)10-4-6-13-2/h7H,3-6,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | LJDSPEMMVCXKGY-ZETCQYMHSA-N |
| XLogP | 0.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|