C7H13N2O3S- — CID 102454632
2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetate (PubChem CID 102454632) has the molecular formula C7H13N2O3S- and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetate.
| Compound Name | 2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetate |
|---|---|
| PubChem CID | 102454632 |
| Molecular Formula | C7H13N2O3S- |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetate |
| SMILES | CSCCC(N)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3S/c1-13-3-2-5(8)7(12)9-4-6(10)11/h5H,2-4,8H2,1H3,(H,9,12)(H,10,11)/p-1 |
| InChIKey | QXOHLNCNYLGICT-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |